C26H26ClF3N4O4 — CID 91181240
3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 91181240) has the molecular formula C26H26ClF3N4O4 and a molecular weight of 550.97 g/mol. Its IUPAC name is 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91181240 |
| Molecular Formula | C26H26ClF3N4O4 |
| Molecular Weight | 550.97 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | O=C1CC(CCc2ccc(O)c(CC(F)(F)F)c2)(C2CCCC2)OC(=O)C1Cc1nc2ncc(Cl)cn2n1 |
| InChI | InChI=1S/C26H26ClF3N4O4/c27-18-13-31-24-32-22(33-34(24)14-18)10-19-21(36)12-25(38-23(19)37,17-3-1-2-4-17)8-7-15-5-6-20(35)16(9-15)11-26(28,29)30/h5-6,9,13-14,17,19,35H,1-4,7-8,10-12H2 |
| InChIKey | IBFWUTPKFHQEJR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|