C11H4FN3 — CID 91181547
2-(2-fluorophenyl)ethene-1,1,2-tricarbonitrile (PubChem CID 91181547) has the molecular formula C11H4FN3 and a molecular weight of 197.17 g/mol. Its IUPAC name is 2-(2-fluorophenyl)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(2-fluorophenyl)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 91181547 |
| Molecular Formula | C11H4FN3 |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-(2-fluorophenyl)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1ccccc1F |
| InChI | InChI=1S/C11H4FN3/c12-11-4-2-1-3-9(11)10(7-15)8(5-13)6-14/h1-4H |
| InChIKey | BIZCSCAXQOGYPB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|