About carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide
carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide (PubChem CID 91181654) has the molecular formula C8H13N3O4S
and a molecular weight of 247.28 g/mol. Its IUPAC name is carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide.
Molecular Properties
| Compound Name | carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide |
| PubChem CID | 91181654 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide |
| SMILES | CCc1cc(NS(C)(=O)=O)n(C)n1.O=C=O |
| InChI | InChI=1S/C7H13N3O2S.CO2/c1-4-6-5-7(10(2)8-6)9-13(3,11)12;2-1-3/h5,9H,4H2,1-3H3; |
| InChIKey | HKGKIOBGWOWGPN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide?
The IUPAC name of carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide (CID 91181654) is carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide.
What is the SMILES notation for carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide?
The canonical SMILES for carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide is CCc1cc(NS(C)(=O)=O)n(C)n1.O=C=O.
What is the InChIKey of carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide?
The InChIKey is HKGKIOBGWOWGPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2S.CO2/c1-4-6-5-7(10(2)8-6)9-13(3,11)12;2-1-3/h5,9H,4H2,1-3H3;.
What are the key properties of carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide?
carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide has a molecular weight of 247.28 g/mol, XLogP of -0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;N-(3-ethyl-1-methylpyrazol-5-yl)methanesulfonamide is sourced from PubChem (CID 91181654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).