C20H22FN5O — CID 91182424
1-[(2-cyanoacetyl)amino]-2-[[2-fluoro-4-(2-propan-2-ylphenyl)phenyl]methyl]guanidine (PubChem CID 91182424) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-[(2-cyanoacetyl)amino]-2-[[2-fluoro-4-(2-propan-2-ylphenyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(2-cyanoacetyl)amino]-2-[[2-fluoro-4-(2-propan-2-ylphenyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 91182424 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[(2-cyanoacetyl)amino]-2-[[2-fluoro-4-(2-propan-2-ylphenyl)phenyl]methyl]guanidine |
| SMILES | CC(C)c1ccccc1-c1ccc(C/N=C(\N)NNC(=O)CC#N)c(F)c1 |
| InChI | InChI=1S/C20H22FN5O/c1-13(2)16-5-3-4-6-17(16)14-7-8-15(18(21)11-14)12-24-20(23)26-25-19(27)9-10-22/h3-8,11,13H,9,12H2,1-2H3,(H,25,27)(H3,23,24,26) |
| InChIKey | ADLIJEVIMQISOO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|