C21H23Cl2F3N4O2 — CID 91141826
2-[[4-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-2-fluorophenyl]methyl]-1-(2,2-dimethylpropanoylamino)guanidine (PubChem CID 91141826) has the molecular formula C21H23Cl2F3N4O2 and a molecular weight of 491.34 g/mol. Its IUPAC name is 2-[[4-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-2-fluorophenyl]methyl]-1-(2,2-dimethylpropanoylamino)guanidine.
| Compound Name | 2-[[4-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-2-fluorophenyl]methyl]-1-(2,2-dimethylpropanoylamino)guanidine |
|---|---|
| PubChem CID | 91141826 |
| Molecular Formula | C21H23Cl2F3N4O2 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-[[4-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-2-fluorophenyl]methyl]-1-(2,2-dimethylpropanoylamino)guanidine |
| SMILES | CC(C)(C)C(=O)NN/C(N)=N/Cc1ccc(-c2cc(Cl)cc(Cl)c2OCC(F)F)cc1F |
| InChI | InChI=1S/C21H23Cl2F3N4O2/c1-21(2,3)19(31)29-30-20(27)28-9-12-5-4-11(6-16(12)24)14-7-13(22)8-15(23)18(14)32-10-17(25)26/h4-8,17H,9-10H2,1-3H3,(H,29,31)(H3,27,28,30) |
| InChIKey | QTCLESYUFDCQOU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|