C19H18Cl2F3N3O4 — CID 87457809
[[[4-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-2-fluorophenyl]-methylcarbamoyl]-ethylamino]carbamic acid (PubChem CID 87457809) has the molecular formula C19H18Cl2F3N3O4 and a molecular weight of 480.27 g/mol. Its IUPAC name is [[[4-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-2-fluorophenyl]-methylcarbamoyl]-ethylamino]carbamic acid.
| Compound Name | [[[4-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-2-fluorophenyl]-methylcarbamoyl]-ethylamino]carbamic acid |
|---|---|
| PubChem CID | 87457809 |
| Molecular Formula | C19H18Cl2F3N3O4 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | [[[4-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-2-fluorophenyl]-methylcarbamoyl]-ethylamino]carbamic acid |
| SMILES | CCN(NC(=O)O)C(=O)N(C)c1ccc(-c2cc(Cl)cc(Cl)c2OCC(F)F)cc1F |
| InChI | InChI=1S/C19H18Cl2F3N3O4/c1-3-27(25-18(28)29)19(30)26(2)15-5-4-10(6-14(15)22)12-7-11(20)8-13(21)17(12)31-9-16(23)24/h4-8,16,25H,3,9H2,1-2H3,(H,28,29) |
| InChIKey | ZPINOMUZRYQYNS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|