C17H15ClF4N4O3 — CID 89039148
1-acetamido-3-[[5-[5-chloro-2-(2,2-difluoroethoxy)-3-fluorophenyl]-3-fluoro-2-pyridinyl]methyl]urea (PubChem CID 89039148) has the molecular formula C17H15ClF4N4O3 and a molecular weight of 434.78 g/mol. Its IUPAC name is 1-acetamido-3-[[5-[5-chloro-2-(2,2-difluoroethoxy)-3-fluorophenyl]-3-fluoro-2-pyridinyl]methyl]urea.
| Compound Name | 1-acetamido-3-[[5-[5-chloro-2-(2,2-difluoroethoxy)-3-fluorophenyl]-3-fluoro-2-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 89039148 |
| Molecular Formula | C17H15ClF4N4O3 |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1-acetamido-3-[[5-[5-chloro-2-(2,2-difluoroethoxy)-3-fluorophenyl]-3-fluoro-2-pyridinyl]methyl]urea |
| SMILES | CC(=O)NNC(=O)NCc1ncc(-c2cc(Cl)cc(F)c2OCC(F)F)cc1F |
| InChI | InChI=1S/C17H15ClF4N4O3/c1-8(27)25-26-17(28)24-6-14-12(19)2-9(5-23-14)11-3-10(18)4-13(20)16(11)29-7-15(21)22/h2-5,15H,6-7H2,1H3,(H,25,27)(H2,24,26,28) |
| InChIKey | NSOYUATWUSLMLL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|