C17H16Cl2F2N4O3 — CID 70858835
1-[(1R)-1-[5-(2,5-dichloro-3-fluorophenyl)-3-fluoro-2-pyridinyl]ethyl]-3-[(2-methoxyacetyl)amino]urea (PubChem CID 70858835) has the molecular formula C17H16Cl2F2N4O3 and a molecular weight of 433.24 g/mol. Its IUPAC name is 1-[(1R)-1-[5-(2,5-dichloro-3-fluorophenyl)-3-fluoro-2-pyridinyl]ethyl]-3-[(2-methoxyacetyl)amino]urea.
| Compound Name | 1-[(1R)-1-[5-(2,5-dichloro-3-fluorophenyl)-3-fluoro-2-pyridinyl]ethyl]-3-[(2-methoxyacetyl)amino]urea |
|---|---|
| PubChem CID | 70858835 |
| Molecular Formula | C17H16Cl2F2N4O3 |
| Molecular Weight | 433.24 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-[(1R)-1-[5-(2,5-dichloro-3-fluorophenyl)-3-fluoro-2-pyridinyl]ethyl]-3-[(2-methoxyacetyl)amino]urea |
| SMILES | COCC(=O)NNC(=O)N[C@H](C)c1ncc(-c2cc(Cl)cc(F)c2Cl)cc1F |
| InChI | InChI=1S/C17H16Cl2F2N4O3/c1-8(23-17(27)25-24-14(26)7-28-2)16-13(21)3-9(6-22-16)11-4-10(18)5-12(20)15(11)19/h3-6,8H,7H2,1-2H3,(H,24,26)(H2,23,25,27)/t8-/m1/s1 |
| InChIKey | SZEUFIICLUDAIW-MRVPVSSYSA-N |
| XLogP | 3.37 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|