C19H14Cl2F4N6O2 — CID 91562808
1-[1-[5-(3,5-dichloro-2-pyrazol-1-ylphenyl)-3-fluoro-2-pyridinyl]ethyl]-3-[(2,2,2-trifluoroacetyl)amino]urea (PubChem CID 91562808) has the molecular formula C19H14Cl2F4N6O2 and a molecular weight of 505.26 g/mol. Its IUPAC name is 1-[1-[5-(3,5-dichloro-2-pyrazol-1-ylphenyl)-3-fluoro-2-pyridinyl]ethyl]-3-[(2,2,2-trifluoroacetyl)amino]urea.
| Compound Name | 1-[1-[5-(3,5-dichloro-2-pyrazol-1-ylphenyl)-3-fluoro-2-pyridinyl]ethyl]-3-[(2,2,2-trifluoroacetyl)amino]urea |
|---|---|
| PubChem CID | 91562808 |
| Molecular Formula | C19H14Cl2F4N6O2 |
| Molecular Weight | 505.26 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 1-[1-[5-(3,5-dichloro-2-pyrazol-1-ylphenyl)-3-fluoro-2-pyridinyl]ethyl]-3-[(2,2,2-trifluoroacetyl)amino]urea |
| SMILES | CC(NC(=O)NNC(=O)C(F)(F)F)c1ncc(-c2cc(Cl)cc(Cl)c2-n2cccn2)cc1F |
| InChI | InChI=1S/C19H14Cl2F4N6O2/c1-9(28-18(33)30-29-17(32)19(23,24)25)15-14(22)5-10(8-26-15)12-6-11(20)7-13(21)16(12)31-4-2-3-27-31/h2-9H,1H3,(H,29,32)(H2,28,30,33) |
| InChIKey | VRGZSGYYCNXKOX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|