C20H21Cl2F3N4O3 — CID 90721230
1-[1-[5-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-3-fluoro-2-pyridinyl]ethyl]-3-(2-methylpropanoylamino)urea (PubChem CID 90721230) has the molecular formula C20H21Cl2F3N4O3 and a molecular weight of 493.31 g/mol. Its IUPAC name is 1-[1-[5-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-3-fluoro-2-pyridinyl]ethyl]-3-(2-methylpropanoylamino)urea.
| Compound Name | 1-[1-[5-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-3-fluoro-2-pyridinyl]ethyl]-3-(2-methylpropanoylamino)urea |
|---|---|
| PubChem CID | 90721230 |
| Molecular Formula | C20H21Cl2F3N4O3 |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 1-[1-[5-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-3-fluoro-2-pyridinyl]ethyl]-3-(2-methylpropanoylamino)urea |
| SMILES | CC(C)C(=O)NNC(=O)NC(C)c1ncc(-c2cc(Cl)cc(Cl)c2OCC(F)F)cc1F |
| InChI | InChI=1S/C20H21Cl2F3N4O3/c1-9(2)19(30)28-29-20(31)27-10(3)17-15(23)4-11(7-26-17)13-5-12(21)6-14(22)18(13)32-8-16(24)25/h4-7,9-10,16H,8H2,1-3H3,(H,28,30)(H2,27,29,31) |
| InChIKey | QSISXGJYLDGBNR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|