C19H16Cl2F2N6O2 — CID 91079653
1-acetamido-3-[1-[5-[3,5-dichloro-2-(4-fluoropyrazol-1-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]urea (PubChem CID 91079653) has the molecular formula C19H16Cl2F2N6O2 and a molecular weight of 469.28 g/mol. Its IUPAC name is 1-acetamido-3-[1-[5-[3,5-dichloro-2-(4-fluoropyrazol-1-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]urea.
| Compound Name | 1-acetamido-3-[1-[5-[3,5-dichloro-2-(4-fluoropyrazol-1-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]urea |
|---|---|
| PubChem CID | 91079653 |
| Molecular Formula | C19H16Cl2F2N6O2 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 1-acetamido-3-[1-[5-[3,5-dichloro-2-(4-fluoropyrazol-1-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]urea |
| SMILES | CC(=O)NNC(=O)NC(C)c1ncc(-c2cc(Cl)cc(Cl)c2-n2cc(F)cn2)cc1F |
| InChI | InChI=1S/C19H16Cl2F2N6O2/c1-9(26-19(31)28-27-10(2)30)17-16(23)3-11(6-24-17)14-4-12(20)5-15(21)18(14)29-8-13(22)7-25-29/h3-9H,1-2H3,(H,27,30)(H2,26,28,31) |
| InChIKey | ZTQNNUVQXQVRCD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|