C23H27ClF4N6O2 — CID 143958533
N-[(1R)-1-[5-[2-[N-[amino(methyl)amino]-N'-methylcarbamimidoyl]-5-chloro-3-fluorophenyl]-3-fluoro-2-pyridinyl]ethyl]-4,4-difluoro-1-hydroxycyclohexane-1-carboxamide (PubChem CID 143958533) has the molecular formula C23H27ClF4N6O2 and a molecular weight of 530.95 g/mol. Its IUPAC name is N-[(1R)-1-[5-[2-[N-[amino(methyl)amino]-N'-methylcarbamimidoyl]-5-chloro-3-fluorophenyl]-3-fluoro-2-pyridinyl]ethyl]-4,4-difluoro-1-hydroxycyclohexane-1-carboxamide.
| Compound Name | N-[(1R)-1-[5-[2-[N-[amino(methyl)amino]-N'-methylcarbamimidoyl]-5-chloro-3-fluorophenyl]-3-fluoro-2-pyridinyl]ethyl]-4,4-difluoro-1-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 143958533 |
| Molecular Formula | C23H27ClF4N6O2 |
| Molecular Weight | 530.95 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | N-[(1R)-1-[5-[2-[N-[amino(methyl)amino]-N'-methylcarbamimidoyl]-5-chloro-3-fluorophenyl]-3-fluoro-2-pyridinyl]ethyl]-4,4-difluoro-1-hydroxycyclohexane-1-carboxamide |
| SMILES | C/N=C(\NN(C)N)c1c(F)cc(Cl)cc1-c1cnc([C@@H](C)NC(=O)C2(O)CCC(F)(F)CC2)c(F)c1 |
| InChI | InChI=1S/C23H27ClF4N6O2/c1-12(32-21(35)22(36)4-6-23(27,28)7-5-22)19-17(26)8-13(11-31-19)15-9-14(24)10-16(25)18(15)20(30-2)33-34(3)29/h8-12,36H,4-7,29H2,1-3H3,(H,30,33)(H,32,35)/t12-/m1/s1 |
| InChIKey | SLNIGSKXQDHBMC-GFCCVEGCSA-N |
| XLogP | 3.48 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.95 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|