C22H22Cl2F5N3O3 — CID 90706567
3-[1-[5-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-(3,3-difluorobut-1-en-2-yloxy)-1-ethylurea (PubChem CID 90706567) has the molecular formula C22H22Cl2F5N3O3 and a molecular weight of 542.33 g/mol. Its IUPAC name is 3-[1-[5-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-(3,3-difluorobut-1-en-2-yloxy)-1-ethylurea.
| Compound Name | 3-[1-[5-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-(3,3-difluorobut-1-en-2-yloxy)-1-ethylurea |
|---|---|
| PubChem CID | 90706567 |
| Molecular Formula | C22H22Cl2F5N3O3 |
| Molecular Weight | 542.33 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 3-[1-[5-[3,5-dichloro-2-(2,2-difluoroethoxy)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-(3,3-difluorobut-1-en-2-yloxy)-1-ethylurea |
| SMILES | C=C(ON(CC)C(=O)NC(C)c1ncc(-c2cc(Cl)cc(Cl)c2OCC(F)F)cc1F)C(C)(F)F |
| InChI | InChI=1S/C22H22Cl2F5N3O3/c1-5-32(35-12(3)22(4,28)29)21(33)31-11(2)19-17(25)6-13(9-30-19)15-7-14(23)8-16(24)20(15)34-10-18(26)27/h6-9,11,18H,3,5,10H2,1-2,4H3,(H,31,33) |
| InChIKey | FRIYRPMZWWQHBE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.33 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|