C18H17ClFN5O3 — CID 90747098
3-[1-[5-[3-chloro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-hydroxy-1-methylurea (PubChem CID 90747098) has the molecular formula C18H17ClFN5O3 and a molecular weight of 405.82 g/mol. Its IUPAC name is 3-[1-[5-[3-chloro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-hydroxy-1-methylurea.
| Compound Name | 3-[1-[5-[3-chloro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-hydroxy-1-methylurea |
|---|---|
| PubChem CID | 90747098 |
| Molecular Formula | C18H17ClFN5O3 |
| Molecular Weight | 405.82 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-[1-[5-[3-chloro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-hydroxy-1-methylurea |
| SMILES | Cc1nc(-c2c(Cl)cccc2-c2cnc(C(C)NC(=O)N(C)O)c(F)c2)no1 |
| InChI | InChI=1S/C18H17ClFN5O3/c1-9(22-18(26)25(3)27)16-14(20)7-11(8-21-16)12-5-4-6-13(19)15(12)17-23-10(2)28-24-17/h4-9,27H,1-3H3,(H,22,26) |
| InChIKey | JLKURFCEVYZTSN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|