C23H22ClF2N5O2 — CID 70858850
3-[(1R)-1-[5-(2-chloro-3-fluorophenyl)-3-fluoro-2-pyridinyl]ethyl]-1-ethyl-1-[(5-methylpyridine-3-carbonyl)amino]urea (PubChem CID 70858850) has the molecular formula C23H22ClF2N5O2 and a molecular weight of 473.91 g/mol. Its IUPAC name is 3-[(1R)-1-[5-(2-chloro-3-fluorophenyl)-3-fluoro-2-pyridinyl]ethyl]-1-ethyl-1-[(5-methylpyridine-3-carbonyl)amino]urea.
| Compound Name | 3-[(1R)-1-[5-(2-chloro-3-fluorophenyl)-3-fluoro-2-pyridinyl]ethyl]-1-ethyl-1-[(5-methylpyridine-3-carbonyl)amino]urea |
|---|---|
| PubChem CID | 70858850 |
| Molecular Formula | C23H22ClF2N5O2 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 3-[(1R)-1-[5-(2-chloro-3-fluorophenyl)-3-fluoro-2-pyridinyl]ethyl]-1-ethyl-1-[(5-methylpyridine-3-carbonyl)amino]urea |
| SMILES | CCN(NC(=O)c1cncc(C)c1)C(=O)N[C@H](C)c1ncc(-c2cccc(F)c2Cl)cc1F |
| InChI | InChI=1S/C23H22ClF2N5O2/c1-4-31(30-22(32)16-8-13(2)10-27-11-16)23(33)29-14(3)21-19(26)9-15(12-28-21)17-6-5-7-18(25)20(17)24/h5-12,14H,4H2,1-3H3,(H,29,33)(H,30,32)/t14-/m1/s1 |
| InChIKey | ORHBECYMPXFGKA-CQSZACIVSA-N |
| XLogP | 4.82 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|