C19H20ClF2N7O2 — CID 46230940
1-tert-butyl-3-[[5-[5-chloro-3-fluoro-2-(2-methyltetrazol-5-yl)phenyl]-3-fluoro-2-pyridinyl]methyl]-1-hydroxyurea (PubChem CID 46230940) has the molecular formula C19H20ClF2N7O2 and a molecular weight of 451.87 g/mol. Its IUPAC name is 1-tert-butyl-3-[[5-[5-chloro-3-fluoro-2-(2-methyltetrazol-5-yl)phenyl]-3-fluoro-2-pyridinyl]methyl]-1-hydroxyurea.
| Compound Name | 1-tert-butyl-3-[[5-[5-chloro-3-fluoro-2-(2-methyltetrazol-5-yl)phenyl]-3-fluoro-2-pyridinyl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 46230940 |
| Molecular Formula | C19H20ClF2N7O2 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-tert-butyl-3-[[5-[5-chloro-3-fluoro-2-(2-methyltetrazol-5-yl)phenyl]-3-fluoro-2-pyridinyl]methyl]-1-hydroxyurea |
| SMILES | Cn1nnc(-c2c(F)cc(Cl)cc2-c2cnc(CNC(=O)N(O)C(C)(C)C)c(F)c2)n1 |
| InChI | InChI=1S/C19H20ClF2N7O2/c1-19(2,3)29(31)18(30)24-9-15-13(21)5-10(8-23-15)12-6-11(20)7-14(22)16(12)17-25-27-28(4)26-17/h5-8,31H,9H2,1-4H3,(H,24,30) |
| InChIKey | YDNCDRQVYZSSRL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|