C19H19Cl2FN6O2 — CID 89039284
3-[[4-[3,5-dichloro-2-(2-methyltetrazol-5-yl)phenyl]-2-fluorophenyl]methyl]-1-hydroxy-1-propan-2-ylurea (PubChem CID 89039284) has the molecular formula C19H19Cl2FN6O2 and a molecular weight of 453.31 g/mol. Its IUPAC name is 3-[[4-[3,5-dichloro-2-(2-methyltetrazol-5-yl)phenyl]-2-fluorophenyl]methyl]-1-hydroxy-1-propan-2-ylurea.
| Compound Name | 3-[[4-[3,5-dichloro-2-(2-methyltetrazol-5-yl)phenyl]-2-fluorophenyl]methyl]-1-hydroxy-1-propan-2-ylurea |
|---|---|
| PubChem CID | 89039284 |
| Molecular Formula | C19H19Cl2FN6O2 |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 3-[[4-[3,5-dichloro-2-(2-methyltetrazol-5-yl)phenyl]-2-fluorophenyl]methyl]-1-hydroxy-1-propan-2-ylurea |
| SMILES | CC(C)N(O)C(=O)NCc1ccc(-c2cc(Cl)cc(Cl)c2-c2nnn(C)n2)cc1F |
| InChI | InChI=1S/C19H19Cl2FN6O2/c1-10(2)28(30)19(29)23-9-12-5-4-11(6-16(12)22)14-7-13(20)8-15(21)17(14)18-24-26-27(3)25-18/h4-8,10,30H,9H2,1-3H3,(H,23,29) |
| InChIKey | CXUHCKHDTADIDK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|