C20H20Cl2FN4O2+ — CID 91035095
3-[[4-[3,5-dichloro-2-(N-ethylidenecarbamimidoyl)phenyl]-2-fluorophenyl]methyl]-1-hydroxy-1-propan-2-ylurea (PubChem CID 91035095) has the molecular formula C20H20Cl2FN4O2+ and a molecular weight of 438.31 g/mol. Its IUPAC name is 3-[[4-[3,5-dichloro-2-(N-ethylidenecarbamimidoyl)phenyl]-2-fluorophenyl]methyl]-1-hydroxy-1-propan-2-ylurea.
| Compound Name | 3-[[4-[3,5-dichloro-2-(N-ethylidenecarbamimidoyl)phenyl]-2-fluorophenyl]methyl]-1-hydroxy-1-propan-2-ylurea |
|---|---|
| PubChem CID | 91035095 |
| Molecular Formula | C20H20Cl2FN4O2+ |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 3-[[4-[3,5-dichloro-2-(N-ethylidenecarbamimidoyl)phenyl]-2-fluorophenyl]methyl]-1-hydroxy-1-propan-2-ylurea |
| SMILES | [H]/N=C(\N=[C+]\C)c1c(Cl)cc(Cl)cc1-c1ccc(CNC(=O)N(O)C(C)C)c(F)c1 |
| InChI | InChI=1S/C20H19Cl2FN4O2/c1-4-25-19(24)18-15(8-14(21)9-16(18)22)12-5-6-13(17(23)7-12)10-26-20(28)27(29)11(2)3/h5-9,11,24,29H,10H2,1-3H3/p+1/b24-19- |
| InChIKey | WTNHHWLLPUOHOR-CLCOLTQESA-O |
| XLogP | 5.40 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|