C21H17Cl2FN6O2 — CID 89039265
4-N-[[4-[3,5-dichloro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-fluorophenyl]methyl]-3-N-prop-1-en-2-yl-1,2,5-oxadiazole-3,4-diamine (PubChem CID 89039265) has the molecular formula C21H17Cl2FN6O2 and a molecular weight of 475.31 g/mol. Its IUPAC name is 4-N-[[4-[3,5-dichloro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-fluorophenyl]methyl]-3-N-prop-1-en-2-yl-1,2,5-oxadiazole-3,4-diamine.
| Compound Name | 4-N-[[4-[3,5-dichloro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-fluorophenyl]methyl]-3-N-prop-1-en-2-yl-1,2,5-oxadiazole-3,4-diamine |
|---|---|
| PubChem CID | 89039265 |
| Molecular Formula | C21H17Cl2FN6O2 |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 4-N-[[4-[3,5-dichloro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-fluorophenyl]methyl]-3-N-prop-1-en-2-yl-1,2,5-oxadiazole-3,4-diamine |
| SMILES | C=C(C)Nc1nonc1NCc1ccc(-c2cc(Cl)cc(Cl)c2-c2noc(C)n2)cc1F |
| InChI | InChI=1S/C21H17Cl2FN6O2/c1-10(2)26-21-20(29-32-30-21)25-9-13-5-4-12(6-17(13)24)15-7-14(22)8-16(23)18(15)19-27-11(3)31-28-19/h4-8H,1,9H2,2-3H3,(H,25,29)(H,26,30) |
| InChIKey | SIKXFNBTKNEDOF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |