C17H19NOS — CID 91183372
2-(2-aminoethyl)-2-phenyl-3,4-dihydrothiochromen-3-ol (PubChem CID 91183372) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-(2-aminoethyl)-2-phenyl-3,4-dihydrothiochromen-3-ol.
| Compound Name | 2-(2-aminoethyl)-2-phenyl-3,4-dihydrothiochromen-3-ol |
|---|---|
| PubChem CID | 91183372 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(2-aminoethyl)-2-phenyl-3,4-dihydrothiochromen-3-ol |
| SMILES | NCCC1(c2ccccc2)Sc2ccccc2CC1O |
| InChI | InChI=1S/C17H19NOS/c18-11-10-17(14-7-2-1-3-8-14)16(19)12-13-6-4-5-9-15(13)20-17/h1-9,16,19H,10-12,18H2 |
| InChIKey | WXSLSNHYOHFLSM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |