C29H36N2O5S — CID 91184546
10-[[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]phenyl]methyl-methylamino]-2-methyl-10-oxodecanoic acid (PubChem CID 91184546) has the molecular formula C29H36N2O5S and a molecular weight of 524.68 g/mol. Its IUPAC name is 10-[[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]phenyl]methyl-methylamino]-2-methyl-10-oxodecanoic acid.
| Compound Name | 10-[[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]phenyl]methyl-methylamino]-2-methyl-10-oxodecanoic acid |
|---|---|
| PubChem CID | 91184546 |
| Molecular Formula | C29H36N2O5S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 10-[[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]phenyl]methyl-methylamino]-2-methyl-10-oxodecanoic acid |
| SMILES | CC(CCCCCCCC(=O)N(C)Cc1cccc(-c2ccc(Cc3sc(=O)[nH]c3O)cc2)c1)C(=O)O |
| InChI | InChI=1S/C29H36N2O5S/c1-20(28(34)35)9-6-4-3-5-7-12-26(32)31(2)19-22-10-8-11-24(17-22)23-15-13-21(14-16-23)18-25-27(33)30-29(36)37-25/h8,10-11,13-17,20,33H,3-7,9,12,18-19H2,1-2H3,(H,30,36)(H,34,35) |
| InChIKey | JOCKAUMBVKQPAG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|