C28H32N4O3 — CID 91185909
N-[2-(diethylamino)ethyl]-4-[2-oxo-3-(4-phenoxyphenyl)imidazolidin-1-yl]benzamide (PubChem CID 91185909) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[2-oxo-3-(4-phenoxyphenyl)imidazolidin-1-yl]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[2-oxo-3-(4-phenoxyphenyl)imidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 91185909 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[2-oxo-3-(4-phenoxyphenyl)imidazolidin-1-yl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(N2CCN(c3ccc(Oc4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H32N4O3/c1-3-30(4-2)19-18-29-27(33)22-10-12-23(13-11-22)31-20-21-32(28(31)34)24-14-16-26(17-15-24)35-25-8-6-5-7-9-25/h5-17H,3-4,18-21H2,1-2H3,(H,29,33) |
| InChIKey | YMGFVFHGIGGDRI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |