C11H15BrN3O2S+ — CID 9118626
(5-bromothiophen-2-yl)methyl-methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium (PubChem CID 9118626) has the molecular formula C11H15BrN3O2S+ and a molecular weight of 333.23 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 9118626 |
| Molecular Formula | C11H15BrN3O2S+ |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium |
| SMILES | C[NH+](CC(=O)N1CCNC1=O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C11H14BrN3O2S/c1-14(6-8-2-3-9(12)18-8)7-10(16)15-5-4-13-11(15)17/h2-3H,4-7H2,1H3,(H,13,17)/p+1 |
| InChIKey | YGSUSEKVHBOLLA-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |