C9H13Cl2N — CID 91186709
(2E)-3,5-dichloro-6-methylocta-2,5-dien-4-imine (PubChem CID 91186709) has the molecular formula C9H13Cl2N and a molecular weight of 206.12 g/mol. Its IUPAC name is (2E)-3,5-dichloro-6-methylocta-2,5-dien-4-imine.
| Compound Name | (2E)-3,5-dichloro-6-methylocta-2,5-dien-4-imine |
|---|---|
| PubChem CID | 91186709 |
| Molecular Formula | C9H13Cl2N |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | (2E)-3,5-dichloro-6-methylocta-2,5-dien-4-imine |
| SMILES | [H]/N=C(C(Cl)=C(C)CC)\C(Cl)=C/C |
| InChI | InChI=1S/C9H13Cl2N/c1-4-6(3)8(11)9(12)7(10)5-2/h5,12H,4H2,1-3H3/b7-5+,8-6?,12-9+ |
| InChIKey | WHYLJZUFXXHAMR-UTORKRMWSA-N |
| XLogP | 4.07 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|