About (E)-3-chlorohex-3-ene-2,5-diimine;ethane
(E)-3-chlorohex-3-ene-2,5-diimine;ethane (PubChem CID 176561080) has the molecular formula C8H15ClN2
and a molecular weight of 174.67 g/mol. Its IUPAC name is (E)-3-chlorohex-3-ene-2,5-diimine;ethane.
Molecular Properties
| Compound Name | (E)-3-chlorohex-3-ene-2,5-diimine;ethane |
| PubChem CID | 176561080 |
| Molecular Formula | C8H15ClN2 |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (E)-3-chlorohex-3-ene-2,5-diimine;ethane |
| SMILES | CC.[H]/N=C(C)/C=C(Cl)\C(C)=N\[H] |
| InChI | InChI=1S/C6H9ClN2.C2H6/c1-4(8)3-6(7)5(2)9;1-2/h3,8-9H,1-2H3;1-2H3/b6-3+,8-4+,9-5+; |
| InChIKey | AMHDCEYIKBNDSE-SAHWHPEISA-N |
| XLogP | 3.21 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-chlorohex-3-ene-2,5-diimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-chlorohex-3-ene-2,5-diimine;ethane?
The IUPAC name of (E)-3-chlorohex-3-ene-2,5-diimine;ethane (CID 176561080) is (E)-3-chlorohex-3-ene-2,5-diimine;ethane.
What is the SMILES notation for (E)-3-chlorohex-3-ene-2,5-diimine;ethane?
The canonical SMILES for (E)-3-chlorohex-3-ene-2,5-diimine;ethane is CC.[H]/N=C(C)/C=C(Cl)\C(C)=N\[H].
What is the InChIKey of (E)-3-chlorohex-3-ene-2,5-diimine;ethane?
The InChIKey is AMHDCEYIKBNDSE-SAHWHPEISA-N. The full InChI is InChI=1S/C6H9ClN2.C2H6/c1-4(8)3-6(7)5(2)9;1-2/h3,8-9H,1-2H3;1-2H3/b6-3+,8-4+,9-5+;.
What are the key properties of (E)-3-chlorohex-3-ene-2,5-diimine;ethane?
(E)-3-chlorohex-3-ene-2,5-diimine;ethane has a molecular weight of 174.67 g/mol, XLogP of 3.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-chlorohex-3-ene-2,5-diimine;ethane is sourced from PubChem (CID 176561080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).