C21H19F5N2O2S — CID 91187009
5-[4-[[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]piperidin-1-yl]-1,3-benzothiazol-4-ol (PubChem CID 91187009) has the molecular formula C21H19F5N2O2S and a molecular weight of 458.45 g/mol. Its IUPAC name is 5-[4-[[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]piperidin-1-yl]-1,3-benzothiazol-4-ol.
| Compound Name | 5-[4-[[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]piperidin-1-yl]-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 91187009 |
| Molecular Formula | C21H19F5N2O2S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 5-[4-[[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]piperidin-1-yl]-1,3-benzothiazol-4-ol |
| SMILES | Oc1c(N2CCC(Cc3ccccc3OC(F)(F)C(F)(F)F)CC2)ccc2scnc12 |
| InChI | InChI=1S/C21H19F5N2O2S/c22-20(23,24)21(25,26)30-16-4-2-1-3-14(16)11-13-7-9-28(10-8-13)15-5-6-17-18(19(15)29)27-12-31-17/h1-6,12-13,29H,7-11H2 |
| InChIKey | PDPTXJYQLGWENH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|