C9H10N2O3 — CID 91190690
(4-carbamoylphenyl)methylcarbamic acid (PubChem CID 91190690) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is (4-carbamoylphenyl)methylcarbamic acid.
| Compound Name | (4-carbamoylphenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 91190690 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (4-carbamoylphenyl)methylcarbamic acid |
| SMILES | NC(=O)c1ccc(CNC(=O)O)cc1 |
| InChI | InChI=1S/C9H10N2O3/c10-8(12)7-3-1-6(2-4-7)5-11-9(13)14/h1-4,11H,5H2,(H2,10,12)(H,13,14) |
| InChIKey | GMMVDPRFZRENFT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |