C23H27N5O6 — CID 91191572
ethyl 2-(2-azidoethoxymethyl)-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 91191572) has the molecular formula C23H27N5O6 and a molecular weight of 469.50 g/mol. Its IUPAC name is ethyl 2-(2-azidoethoxymethyl)-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 2-(2-azidoethoxymethyl)-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 91191572 |
| Molecular Formula | C23H27N5O6 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | ethyl 2-(2-azidoethoxymethyl)-7,7-dimethyl-4-(3-nitrophenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=C(COCCN=[N+]=[N-])N=C2CC(C)(C)CC(=O)C2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27N5O6/c1-4-34-22(30)21-17(13-33-9-8-25-27-24)26-16-11-23(2,3)12-18(29)20(16)19(21)14-6-5-7-15(10-14)28(31)32/h5-7,10,19-20H,4,8-9,11-13H2,1-3H3 |
| InChIKey | RTLPDLRERFRXGH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 156.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|