C14H30N2O3 — CID 91191848
3-(methylamino)-N-(2-methylpropyl)butanamide;3-methylbutanoic acid (PubChem CID 91191848) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is 3-(methylamino)-N-(2-methylpropyl)butanamide;3-methylbutanoic acid.
| Compound Name | 3-(methylamino)-N-(2-methylpropyl)butanamide;3-methylbutanoic acid |
|---|---|
| PubChem CID | 91191848 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 3-(methylamino)-N-(2-methylpropyl)butanamide;3-methylbutanoic acid |
| SMILES | CC(C)CC(=O)O.CNC(C)CC(=O)NCC(C)C |
| InChI | InChI=1S/C9H20N2O.C5H10O2/c1-7(2)6-11-9(12)5-8(3)10-4;1-4(2)3-5(6)7/h7-8,10H,5-6H2,1-4H3,(H,11,12);4H,3H2,1-2H3,(H,6,7) |
| InChIKey | ZSMZHRZHBVYDCK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |