C11H10F3NS — CID 91193396
2,3-dimethyl-6-(trifluoromethyl)-2H-1,4-benzothiazine (PubChem CID 91193396) has the molecular formula C11H10F3NS and a molecular weight of 245.27 g/mol. Its IUPAC name is 2,3-dimethyl-6-(trifluoromethyl)-2H-1,4-benzothiazine.
| Compound Name | 2,3-dimethyl-6-(trifluoromethyl)-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 91193396 |
| Molecular Formula | C11H10F3NS |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2,3-dimethyl-6-(trifluoromethyl)-2H-1,4-benzothiazine |
| SMILES | CC1=Nc2cc(C(F)(F)F)ccc2SC1C |
| InChI | InChI=1S/C11H10F3NS/c1-6-7(2)16-10-4-3-8(11(12,13)14)5-9(10)15-6/h3-5,7H,1-2H3 |
| InChIKey | ANPGARFWKBUVGS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |