C23H24F3N3O2S — CID 91193826
6-(6-cyclopropyl-1-methylindol-2-yl)-N-prop-2-enyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide (PubChem CID 91193826) has the molecular formula C23H24F3N3O2S and a molecular weight of 463.53 g/mol. Its IUPAC name is 6-(6-cyclopropyl-1-methylindol-2-yl)-N-prop-2-enyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-(6-cyclopropyl-1-methylindol-2-yl)-N-prop-2-enyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 91193826 |
| Molecular Formula | C23H24F3N3O2S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 6-(6-cyclopropyl-1-methylindol-2-yl)-N-prop-2-enyl-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide |
| SMILES | C=CCN(C(C)C(F)(F)F)S(=O)(=O)c1ccc(-c2cc3ccc(C4CC4)cc3n2C)nc1 |
| InChI | InChI=1S/C23H24F3N3O2S/c1-4-11-29(15(2)23(24,25)26)32(30,31)19-9-10-20(27-14-19)22-13-18-8-7-17(16-5-6-16)12-21(18)28(22)3/h4,7-10,12-16H,1,5-6,11H2,2-3H3 |
| InChIKey | GGOWRMRTLALABW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|