C40H40ClN5O6S — CID 91194010
4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-5-yloxy)-3-(3-nitrophenyl)sulfonylbenzamide (PubChem CID 91194010) has the molecular formula C40H40ClN5O6S and a molecular weight of 754.31 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-5-yloxy)-3-(3-nitrophenyl)sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-5-yloxy)-3-(3-nitrophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 91194010 |
| Molecular Formula | C40H40ClN5O6S |
| Molecular Weight | 754.31 g/mol |
| Exact Mass | 753.24 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-5-yloxy)-3-(3-nitrophenyl)sulfonylbenzamide |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C(N)=O)c(Oc4ccc5[nH]ccc5c4)c3S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C40H40ClN5O6S/c1-40(2)16-14-28(34(24-40)26-6-8-29(41)9-7-26)25-44-18-20-45(21-19-44)36-13-11-33(39(42)47)37(52-31-10-12-35-27(22-31)15-17-43-35)38(36)53(50,51)32-5-3-4-30(23-32)46(48)49/h3-13,15,17,22-23,43H,14,16,18-21,24-25H2,1-2H3,(H2,42,47) |
| InChIKey | VDALLPADYGZEMY-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 151.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.31 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|