C23H29N3O — CID 9119487
N-[2-(4-methylpiperazin-1-yl)phenyl]-1-phenylcyclopentane-1-carboxamide (PubChem CID 9119487) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)phenyl]-1-phenylcyclopentane-1-carboxamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)phenyl]-1-phenylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 9119487 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)phenyl]-1-phenylcyclopentane-1-carboxamide |
| SMILES | CN1CCN(c2ccccc2NC(=O)C2(c3ccccc3)CCCC2)CC1 |
| InChI | InChI=1S/C23H29N3O/c1-25-15-17-26(18-16-25)21-12-6-5-11-20(21)24-22(27)23(13-7-8-14-23)19-9-3-2-4-10-19/h2-6,9-12H,7-8,13-18H2,1H3,(H,24,27) |
| InChIKey | FKOWYHLXAYBTAY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |