C19H23N5O3S3 — CID 91195331
azanium 3-ethyl-2-[(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1,3-benzothiazole-6-sulfonate (PubChem CID 91195331) has the molecular formula C19H23N5O3S3 and a molecular weight of 465.63 g/mol. Its IUPAC name is azanium 3-ethyl-2-[(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1,3-benzothiazole-6-sulfonate.
| Compound Name | azanium 3-ethyl-2-[(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1,3-benzothiazole-6-sulfonate |
|---|---|
| PubChem CID | 91195331 |
| Molecular Formula | C19H23N5O3S3 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | azanium 3-ethyl-2-[(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1,3-benzothiazole-6-sulfonate |
| SMILES | CCn1c(=NN=c2sc3cc(S(=O)(=O)[O-])ccc3n2CC)sc2cc(C)ccc21.[NH4+] |
| InChI | InChI=1S/C19H20N4O3S3.H3N/c1-4-22-14-8-6-12(3)10-16(14)27-18(22)20-21-19-23(5-2)15-9-7-13(29(24,25)26)11-17(15)28-19;/h6-11H,4-5H2,1-3H3,(H,24,25,26);1H3 |
| InChIKey | HFKPEDGAJYWKIW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|