C18H20N6O6S4 — CID 57111806
[3-ethyl-2-[[3-ethyl-6-(sulfoamino)-1,3-benzothiazol-2-ylidene]hydrazinylidene]-1,3-benzothiazol-6-yl]sulfamic acid (PubChem CID 57111806) has the molecular formula C18H20N6O6S4 and a molecular weight of 544.66 g/mol. Its IUPAC name is [3-ethyl-2-[[3-ethyl-6-(sulfoamino)-1,3-benzothiazol-2-ylidene]hydrazinylidene]-1,3-benzothiazol-6-yl]sulfamic acid.
| Compound Name | [3-ethyl-2-[[3-ethyl-6-(sulfoamino)-1,3-benzothiazol-2-ylidene]hydrazinylidene]-1,3-benzothiazol-6-yl]sulfamic acid |
|---|---|
| PubChem CID | 57111806 |
| Molecular Formula | C18H20N6O6S4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | [3-ethyl-2-[[3-ethyl-6-(sulfoamino)-1,3-benzothiazol-2-ylidene]hydrazinylidene]-1,3-benzothiazol-6-yl]sulfamic acid |
| SMILES | CCn1c(=NN=c2sc3cc(NS(=O)(=O)O)ccc3n2CC)sc2cc(NS(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C18H20N6O6S4/c1-3-23-13-7-5-11(21-33(25,26)27)9-15(13)31-17(23)19-20-18-24(4-2)14-8-6-12(10-16(14)32-18)22-34(28,29)30/h5-10,21-22H,3-4H2,1-2H3,(H,25,26,27)(H,28,29,30) |
| InChIKey | LYANZGVIGVDWCE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|