C20H28O4 — CID 91195571
(8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-17-methoxy-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthren-4-one (PubChem CID 91195571) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-17-methoxy-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthren-4-one.
| Compound Name | (8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-17-methoxy-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthren-4-one |
|---|---|
| PubChem CID | 91195571 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-17-methoxy-10,13-dimethyl-5,8,9,11,12,14,15,16-octahydro-3H-cyclopenta[a]phenanthren-4-one |
| SMILES | CO[C@]1(O)CC[C@H]2[C@@H]3C=CC4C(=O)C(O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C20H28O4/c1-18-9-8-16(21)17(22)15(18)5-4-12-13(18)6-10-19(2)14(12)7-11-20(19,23)24-3/h4-5,8-9,12-16,21,23H,6-7,10-11H2,1-3H3/t12-,13+,14+,15?,16?,18-,19+,20-/m1/s1 |
| InChIKey | OZJJYKYZKQGFPH-ZDHLWBKJSA-N |
| XLogP | 2.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|