C21H27N3O3S — CID 91197707
N-(3-cyclohexylpropanoyl)-1-(2-oxo-2-thiophen-2-ylethyl)-4H-pyridine-3-carbohydrazide (PubChem CID 91197707) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-(3-cyclohexylpropanoyl)-1-(2-oxo-2-thiophen-2-ylethyl)-4H-pyridine-3-carbohydrazide.
| Compound Name | N-(3-cyclohexylpropanoyl)-1-(2-oxo-2-thiophen-2-ylethyl)-4H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 91197707 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-(3-cyclohexylpropanoyl)-1-(2-oxo-2-thiophen-2-ylethyl)-4H-pyridine-3-carbohydrazide |
| SMILES | NN(C(=O)CCC1CCCCC1)C(=O)C1=CN(CC(=O)c2cccs2)C=CC1 |
| InChI | InChI=1S/C21H27N3O3S/c22-24(20(26)11-10-16-6-2-1-3-7-16)21(27)17-8-4-12-23(14-17)15-18(25)19-9-5-13-28-19/h4-5,9,12-14,16H,1-3,6-8,10-11,15,22H2 |
| InChIKey | JRUNUVOXLBZYKY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|