C14H17N3O4S2 — CID 91528161
5-methyl-N-methylsulfonyl-1-(2-oxo-2-thiophen-2-ylethyl)-4H-pyridine-3-carbohydrazide (PubChem CID 91528161) has the molecular formula C14H17N3O4S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 5-methyl-N-methylsulfonyl-1-(2-oxo-2-thiophen-2-ylethyl)-4H-pyridine-3-carbohydrazide.
| Compound Name | 5-methyl-N-methylsulfonyl-1-(2-oxo-2-thiophen-2-ylethyl)-4H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 91528161 |
| Molecular Formula | C14H17N3O4S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 5-methyl-N-methylsulfonyl-1-(2-oxo-2-thiophen-2-ylethyl)-4H-pyridine-3-carbohydrazide |
| SMILES | CC1=CN(CC(=O)c2cccs2)C=C(C(=O)N(N)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H17N3O4S2/c1-10-6-11(14(19)17(15)23(2,20)21)8-16(7-10)9-12(18)13-4-3-5-22-13/h3-5,7-8H,6,9,15H2,1-2H3 |
| InChIKey | VFVXOAABVSOLDN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|