C13H19N3O4S2 — CID 91170512
N-methylsulfonyl-1-(2-oxo-2-thiophen-2-ylethyl)piperidine-3-carbohydrazide (PubChem CID 91170512) has the molecular formula C13H19N3O4S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-methylsulfonyl-1-(2-oxo-2-thiophen-2-ylethyl)piperidine-3-carbohydrazide.
| Compound Name | N-methylsulfonyl-1-(2-oxo-2-thiophen-2-ylethyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 91170512 |
| Molecular Formula | C13H19N3O4S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-methylsulfonyl-1-(2-oxo-2-thiophen-2-ylethyl)piperidine-3-carbohydrazide |
| SMILES | CS(=O)(=O)N(N)C(=O)C1CCCN(CC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C13H19N3O4S2/c1-22(19,20)16(14)13(18)10-4-2-6-15(8-10)9-11(17)12-5-3-7-21-12/h3,5,7,10H,2,4,6,8-9,14H2,1H3 |
| InChIKey | ULVFGFSCEYBIDC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|