C16H26O2 — CID 91197714
2-ethyl-1,3-bis[(2-methylpropan-2-yl)oxy]benzene (PubChem CID 91197714) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-ethyl-1,3-bis[(2-methylpropan-2-yl)oxy]benzene.
| Compound Name | 2-ethyl-1,3-bis[(2-methylpropan-2-yl)oxy]benzene |
|---|---|
| PubChem CID | 91197714 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-ethyl-1,3-bis[(2-methylpropan-2-yl)oxy]benzene |
| SMILES | CCc1c(OC(C)(C)C)cccc1OC(C)(C)C |
| InChI | InChI=1S/C16H26O2/c1-8-12-13(17-15(2,3)4)10-9-11-14(12)18-16(5,6)7/h9-11H,8H2,1-7H3 |
| InChIKey | DGYWFCVRAFNYCQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |