C14H21ClO2 — CID 68785646
2-chloro-1,3-bis[(2-methylpropan-2-yl)oxy]benzene (PubChem CID 68785646) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is 2-chloro-1,3-bis[(2-methylpropan-2-yl)oxy]benzene.
| Compound Name | 2-chloro-1,3-bis[(2-methylpropan-2-yl)oxy]benzene |
|---|---|
| PubChem CID | 68785646 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-chloro-1,3-bis[(2-methylpropan-2-yl)oxy]benzene |
| SMILES | CC(C)(C)Oc1cccc(OC(C)(C)C)c1Cl |
| InChI | InChI=1S/C14H21ClO2/c1-13(2,3)16-10-8-7-9-11(12(10)15)17-14(4,5)6/h7-9H,1-6H3 |
| InChIKey | VXTNNUPZHSIRGS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |