C14H20Cl2O — CID 70807903
1,2-dichloro-3-(2,4,4-trimethylpentan-2-yloxy)benzene (PubChem CID 70807903) has the molecular formula C14H20Cl2O and a molecular weight of 275.22 g/mol. Its IUPAC name is 1,2-dichloro-3-(2,4,4-trimethylpentan-2-yloxy)benzene.
| Compound Name | 1,2-dichloro-3-(2,4,4-trimethylpentan-2-yloxy)benzene |
|---|---|
| PubChem CID | 70807903 |
| Molecular Formula | C14H20Cl2O |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1,2-dichloro-3-(2,4,4-trimethylpentan-2-yloxy)benzene |
| SMILES | CC(C)(C)CC(C)(C)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl2O/c1-13(2,3)9-14(4,5)17-11-8-6-7-10(15)12(11)16/h6-8H,9H2,1-5H3 |
| InChIKey | LNGNNFXDTXVHMQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |