C24H31ClN2O2 — CID 91198671
N-[(4-chlorophenyl)methyl]-2-(4-methoxyphenyl)-N-(1-propan-2-ylpiperidin-2-yl)acetamide (PubChem CID 91198671) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(4-methoxyphenyl)-N-(1-propan-2-ylpiperidin-2-yl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(4-methoxyphenyl)-N-(1-propan-2-ylpiperidin-2-yl)acetamide |
|---|---|
| PubChem CID | 91198671 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(4-methoxyphenyl)-N-(1-propan-2-ylpiperidin-2-yl)acetamide |
| SMILES | COc1ccc(CC(=O)N(Cc2ccc(Cl)cc2)C2CCCCN2C(C)C)cc1 |
| InChI | InChI=1S/C24H31ClN2O2/c1-18(2)26-15-5-4-6-23(26)27(17-20-7-11-21(25)12-8-20)24(28)16-19-9-13-22(29-3)14-10-19/h7-14,18,23H,4-6,15-17H2,1-3H3 |
| InChIKey | YKQMLOAMBDASLR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |