C18H16N2O2 — CID 91199484
5-(1,3-dihydroisoindol-2-ylmethyl)-2-methylisoindole-1,3-dione (PubChem CID 91199484) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-(1,3-dihydroisoindol-2-ylmethyl)-2-methylisoindole-1,3-dione.
| Compound Name | 5-(1,3-dihydroisoindol-2-ylmethyl)-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 91199484 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-(1,3-dihydroisoindol-2-ylmethyl)-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(CN3Cc4ccccc4C3)cc2C1=O |
| InChI | InChI=1S/C18H16N2O2/c1-19-17(21)15-7-6-12(8-16(15)18(19)22)9-20-10-13-4-2-3-5-14(13)11-20/h2-8H,9-11H2,1H3 |
| InChIKey | CLXPEFYSPDKDPE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|