C22H24ClFN2O3S — CID 91199704
1-[1-(2-chloro-4-fluorophenyl)-5-methyl-4-[(4-methylsulfonylanilino)methyl]pyrrol-2-yl]propan-2-ol (PubChem CID 91199704) has the molecular formula C22H24ClFN2O3S and a molecular weight of 450.96 g/mol. Its IUPAC name is 1-[1-(2-chloro-4-fluorophenyl)-5-methyl-4-[(4-methylsulfonylanilino)methyl]pyrrol-2-yl]propan-2-ol.
| Compound Name | 1-[1-(2-chloro-4-fluorophenyl)-5-methyl-4-[(4-methylsulfonylanilino)methyl]pyrrol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 91199704 |
| Molecular Formula | C22H24ClFN2O3S |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 1-[1-(2-chloro-4-fluorophenyl)-5-methyl-4-[(4-methylsulfonylanilino)methyl]pyrrol-2-yl]propan-2-ol |
| SMILES | Cc1c(CNc2ccc(S(C)(=O)=O)cc2)cc(CC(C)O)n1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H24ClFN2O3S/c1-14(27)10-19-11-16(13-25-18-5-7-20(8-6-18)30(3,28)29)15(2)26(19)22-9-4-17(24)12-21(22)23/h4-9,11-12,14,25,27H,10,13H2,1-3H3 |
| InChIKey | ICSBQKOSQJWLEV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|