C21H19ClF2N2O3S — CID 58482993
1-(2-chloro-4-fluorophenyl)-5-(2-fluoroethyl)-2-methyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide (PubChem CID 58482993) has the molecular formula C21H19ClF2N2O3S and a molecular weight of 452.91 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-5-(2-fluoroethyl)-2-methyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-5-(2-fluoroethyl)-2-methyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58482993 |
| Molecular Formula | C21H19ClF2N2O3S |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-5-(2-fluoroethyl)-2-methyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(S(C)(=O)=O)cc2)cc(CCF)n1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H19ClF2N2O3S/c1-13-18(21(27)25-15-4-6-17(7-5-15)30(2,28)29)12-16(9-10-23)26(13)20-8-3-14(24)11-19(20)22/h3-8,11-12H,9-10H2,1-2H3,(H,25,27) |
| InChIKey | JOLHQGOEQLZXOU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|