C21H19ClF3N3O4S — CID 67448348
1-[4-chloro-2-(trifluoromethyl)phenyl]-5-(2-hydroxyethyl)-2-methyl-N-(4-sulfamoylphenyl)pyrrole-3-carboxamide (PubChem CID 67448348) has the molecular formula C21H19ClF3N3O4S and a molecular weight of 501.91 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-5-(2-hydroxyethyl)-2-methyl-N-(4-sulfamoylphenyl)pyrrole-3-carboxamide.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-5-(2-hydroxyethyl)-2-methyl-N-(4-sulfamoylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67448348 |
| Molecular Formula | C21H19ClF3N3O4S |
| Molecular Weight | 501.91 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-5-(2-hydroxyethyl)-2-methyl-N-(4-sulfamoylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc(CCO)n1-c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C21H19ClF3N3O4S/c1-12-17(20(30)27-14-3-5-16(6-4-14)33(26,31)32)11-15(8-9-29)28(12)19-7-2-13(22)10-18(19)21(23,24)25/h2-7,10-11,29H,8-9H2,1H3,(H,27,30)(H2,26,31,32) |
| InChIKey | OQDSVUYIOKSPEC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|