C22H22ClFN2O3S — CID 45279096
1-(4-chloro-2-methylphenyl)-5-(2-fluoroethyl)-2-methyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide (PubChem CID 45279096) has the molecular formula C22H22ClFN2O3S and a molecular weight of 448.95 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-5-(2-fluoroethyl)-2-methyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide.
| Compound Name | 1-(4-chloro-2-methylphenyl)-5-(2-fluoroethyl)-2-methyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45279096 |
| Molecular Formula | C22H22ClFN2O3S |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-5-(2-fluoroethyl)-2-methyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(Cl)ccc1-n1c(CCF)cc(C(=O)Nc2ccc(S(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C22H22ClFN2O3S/c1-14-12-16(23)4-9-21(14)26-15(2)20(13-18(26)10-11-24)22(27)25-17-5-7-19(8-6-17)30(3,28)29/h4-9,12-13H,10-11H2,1-3H3,(H,25,27) |
| InChIKey | JIGQIQDNHUWUJR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|