C20H21N3O2 — CID 91199817
3-(6-amino-3-pyridinyl)-N-methyl-N-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]prop-2-enamide (PubChem CID 91199817) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)-N-methyl-N-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(6-amino-3-pyridinyl)-N-methyl-N-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 91199817 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)-N-methyl-N-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]prop-2-enamide |
| SMILES | Cc1c([C@@H](C)N(C)C(=O)C=Cc2ccc(N)nc2)oc2ccccc12 |
| InChI | InChI=1S/C20H21N3O2/c1-13-16-6-4-5-7-17(16)25-20(13)14(2)23(3)19(24)11-9-15-8-10-18(21)22-12-15/h4-12,14H,1-3H3,(H2,21,22)/t14-/m1/s1 |
| InChIKey | KVDUFRPEQMFRIQ-CQSZACIVSA-N |
| XLogP | 3.95 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|