C19H22O5 — CID 91202911
3-hydroxy-2-[4-(2-methoxyethoxy)-2-phenylmethoxyphenyl]propanal (PubChem CID 91202911) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-hydroxy-2-[4-(2-methoxyethoxy)-2-phenylmethoxyphenyl]propanal.
| Compound Name | 3-hydroxy-2-[4-(2-methoxyethoxy)-2-phenylmethoxyphenyl]propanal |
|---|---|
| PubChem CID | 91202911 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-hydroxy-2-[4-(2-methoxyethoxy)-2-phenylmethoxyphenyl]propanal |
| SMILES | COCCOc1ccc(C(C=O)CO)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H22O5/c1-22-9-10-23-17-7-8-18(16(12-20)13-21)19(11-17)24-14-15-5-3-2-4-6-15/h2-8,11-12,16,21H,9-10,13-14H2,1H3 |
| InChIKey | IMGUCXFXQWNEAF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|